C19H27ClN4O — CID 111996249
N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 111996249) has the molecular formula C19H27ClN4O and a molecular weight of 362.91 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111996249 |
| Molecular Formula | C19H27ClN4O |
| Molecular Weight | 362.91 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1Cl)N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C19H27ClN4O/c1-2-21-19(22-13-18(25)16-7-3-4-8-17(16)20)24-12-9-15(14-24)23-10-5-6-11-23/h3-8,15,18,25H,2,9-14H2,1H3,(H,21,22) |
| InChIKey | QNUKCABVNNDILQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.91 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|