C21H33FN4O — CID 111996315
N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111996315) has the molecular formula C21H33FN4O and a molecular weight of 376.52 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111996315 |
| Molecular Formula | C21H33FN4O |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(piperidin-1-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)N1CCC(CN2CCCCC2)C1 |
| InChI | InChI=1S/C21H33FN4O/c1-2-23-21(24-14-20(27)18-8-4-5-9-19(18)22)26-13-10-17(16-26)15-25-11-6-3-7-12-25/h4-5,8-9,17,20,27H,2-3,6-7,10-16H2,1H3,(H,23,24) |
| InChIKey | YYEZPOIGJFYWOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|