C20H29FN4O3 — CID 111300743
N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111300743) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111300743 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-ethyl-N'-[2-(2-fluorophenyl)-2-hydroxyethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H29FN4O3/c1-2-22-20(23-14-17(26)15-6-3-4-7-16(15)21)25-11-9-24(10-12-25)19(27)18-8-5-13-28-18/h3-4,6-7,17-18,26H,2,5,8-14H2,1H3,(H,22,23) |
| InChIKey | NTYVYDBNEDAJPO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|