C20H29FN4O2 — CID 111301731
N-ethyl-N'-[2-(3-fluorophenyl)ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301731) has the molecular formula C20H29FN4O2 and a molecular weight of 376.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-fluorophenyl)ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(3-fluorophenyl)ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301731 |
| Molecular Formula | C20H29FN4O2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-ethyl-N'-[2-(3-fluorophenyl)ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cccc(F)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H29FN4O2/c1-2-22-20(23-9-8-16-5-3-6-17(21)15-16)25-12-10-24(11-13-25)19(26)18-7-4-14-27-18/h3,5-6,15,18H,2,4,7-14H2,1H3,(H,22,23) |
| InChIKey | JSZMAFCQLLDRDK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|