C21H31FN4O2S — CID 111301353
N-ethyl-N'-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301353) has the molecular formula C21H31FN4O2S and a molecular weight of 422.57 g/mol. Its IUPAC name is N-ethyl-N'-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301353 |
| Molecular Formula | C21H31FN4O2S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-ethyl-N'-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCSCc1ccccc1F)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H31FN4O2S/c1-2-23-21(24-9-15-29-16-17-6-3-4-7-18(17)22)26-12-10-25(11-13-26)20(27)19-8-5-14-28-19/h3-4,6-7,19H,2,5,8-16H2,1H3,(H,23,24) |
| InChIKey | MAGHIQBZIVGNTE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|