C21H30ClN5O3 — CID 111301625
2-chloro-N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]benzamide (PubChem CID 111301625) has the molecular formula C21H30ClN5O3 and a molecular weight of 435.96 g/mol. Its IUPAC name is 2-chloro-N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111301625 |
| Molecular Formula | C21H30ClN5O3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-chloro-N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1Cl)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H30ClN5O3/c1-2-23-21(25-10-9-24-19(28)16-6-3-4-7-17(16)22)27-13-11-26(12-14-27)20(29)18-8-5-15-30-18/h3-4,6-7,18H,2,5,8-15H2,1H3,(H,23,25)(H,24,28) |
| InChIKey | YSYRYICDWKJCMH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|