C19H27ClN4O2 — CID 111300851
N'-[(3-chlorophenyl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111300851) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is N'-[(3-chlorophenyl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(3-chlorophenyl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111300851 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N'-[(3-chlorophenyl)methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(Cl)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H27ClN4O2/c1-2-21-19(22-14-15-5-3-6-16(20)13-15)24-10-8-23(9-11-24)18(25)17-7-4-12-26-17/h3,5-6,13,17H,2,4,7-12,14H2,1H3,(H,21,22) |
| InChIKey | JGKOKDKWUULGLI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|