C22H35N5O2 — CID 111301691
N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301691) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301691 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | N'-[[4-[(dimethylamino)methyl]phenyl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(CN(C)C)cc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C22H35N5O2/c1-4-23-22(24-16-18-7-9-19(10-8-18)17-25(2)3)27-13-11-26(12-14-27)21(28)20-6-5-15-29-20/h7-10,20H,4-6,11-17H2,1-3H3,(H,23,24) |
| InChIKey | WCZDHAGLYUSARY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|