C23H36IN5O3 — CID 111301702
N-[4-[[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide (PubChem CID 111301702) has the molecular formula C23H36IN5O3 and a molecular weight of 557.48 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[4-[[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111301702 |
| Molecular Formula | C23H36IN5O3 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | N-[4-[[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)C(C)C)cc1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C23H35N5O3.HI/c1-4-24-23(25-16-18-7-9-19(10-8-18)26-21(29)17(2)3)28-13-11-27(12-14-28)22(30)20-6-5-15-31-20;/h7-10,17,20H,4-6,11-16H2,1-3H3,(H,24,25)(H,26,29);1H |
| InChIKey | MBWPXIJCNREIPX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|