C23H32N6O2 — CID 111301015
N-ethyl-N'-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111301015) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111301015 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-ethyl-N'-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccnc2)cc1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C23H32N6O2/c1-2-25-23(29-13-11-28(12-14-29)22(30)21-4-3-15-31-21)26-16-19-5-7-20(8-6-19)17-27-10-9-24-18-27/h5-10,18,21H,2-4,11-17H2,1H3,(H,25,26) |
| InChIKey | WVFYJDGGSKWSSA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|