C18H32IN5O3 — CID 111301646
N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111301646) has the molecular formula C18H32IN5O3 and a molecular weight of 493.39 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111301646 |
| Molecular Formula | C18H32IN5O3 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C1CC1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C18H31N5O3.HI/c1-2-19-18(21-8-7-20-16(24)14-5-6-14)23-11-9-22(10-12-23)17(25)15-4-3-13-26-15;/h14-15H,2-13H2,1H3,(H,19,21)(H,20,24);1H |
| InChIKey | JFZNPAXMKXFKKH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|