C18H32N4O4 — CID 111300333
methyl 5-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]pentanoate (PubChem CID 111300333) has the molecular formula C18H32N4O4 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 5-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]pentanoate.
| Compound Name | methyl 5-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 111300333 |
| Molecular Formula | C18H32N4O4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | methyl 5-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]pentanoate |
| SMILES | CCN/C(=N\CCCCC(=O)OC)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C18H32N4O4/c1-3-19-18(20-9-5-4-8-16(23)25-2)22-12-10-21(11-13-22)17(24)15-7-6-14-26-15/h15H,3-14H2,1-2H3,(H,19,20) |
| InChIKey | JZOANTWTOCGLEI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|