C19H30IN5O4 — CID 111301788
N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111301788) has the molecular formula C19H30IN5O4 and a molecular weight of 519.38 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111301788 |
| Molecular Formula | C19H30IN5O4 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccco1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C19H29N5O4.HI/c1-2-20-19(22-8-7-21-17(25)15-5-3-13-27-15)24-11-9-23(10-12-24)18(26)16-6-4-14-28-16;/h3,5,13,16H,2,4,6-12,14H2,1H3,(H,20,22)(H,21,25);1H |
| InChIKey | SSGXLCLFQHIDMT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|