C18H27IN4O3 — CID 119144681
N-[2-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 119144681) has the molecular formula C18H27IN4O3 and a molecular weight of 474.34 g/mol. Its IUPAC name is N-[2-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 119144681 |
| Molecular Formula | C18H27IN4O3 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-[2-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccco1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C18H26N4O3.HI/c1-2-19-18(21-8-7-20-17(23)16-4-3-9-24-16)22-10-12-13(11-22)15-6-5-14(12)25-15;/h3-4,9,12-15H,2,5-8,10-11H2,1H3,(H,19,21)(H,20,23);1H |
| InChIKey | DBLHDEUTHGDIHE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|