C15H26IN3O3 — CID 119145039
methyl 3-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]propanoate;hydroiodide (PubChem CID 119145039) has the molecular formula C15H26IN3O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is methyl 3-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 119145039 |
| Molecular Formula | C15H26IN3O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | methyl 3-[[1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl(ethylamino)methylidene]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)OC)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C15H25N3O3.HI/c1-3-16-15(17-7-6-14(19)20-2)18-8-10-11(9-18)13-5-4-12(10)21-13;/h10-13H,3-9H2,1-2H3,(H,16,17);1H |
| InChIKey | ZIQHAMSIINNOJH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|