C15H28IN3O — CID 119144539
N-ethyl-N'-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144539) has the molecular formula C15H28IN3O and a molecular weight of 393.31 g/mol. Its IUPAC name is N-ethyl-N'-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144539 |
| Molecular Formula | C15H28IN3O |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-ethyl-N'-(2-methylpropyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C15H27N3O.HI/c1-4-16-15(17-7-10(2)3)18-8-11-12(9-18)14-6-5-13(11)19-14;/h10-14H,4-9H2,1-3H3,(H,16,17);1H |
| InChIKey | DWANCJWYWLPXEV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|