C20H36N4O — CID 119144724
N-ethyl-N'-[2-(2-methylpiperidin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144724) has the molecular formula C20H36N4O and a molecular weight of 348.54 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-methylpiperidin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-methylpiperidin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144724 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | N-ethyl-N'-[2-(2-methylpiperidin-1-yl)propyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCCCC1C)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C20H36N4O/c1-4-21-20(22-11-15(3)24-10-6-5-7-14(24)2)23-12-16-17(13-23)19-9-8-18(16)25-19/h14-19H,4-13H2,1-3H3,(H,21,22) |
| InChIKey | GRKDWQPOAKMRAI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|