C18H29F3N4O — CID 119144874
N-ethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144874) has the molecular formula C18H29F3N4O and a molecular weight of 374.45 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144874 |
| Molecular Formula | C18H29F3N4O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-ethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C18H29F3N4O/c1-2-22-17(23-7-12-5-6-24(8-12)11-18(19,20)21)25-9-13-14(10-25)16-4-3-15(13)26-16/h12-16H,2-11H2,1H3,(H,22,23) |
| InChIKey | TWAQVZJDXFQXFW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|