C16H29F3N4S — CID 109489927
N-ethyl-2,2-dimethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109489927) has the molecular formula C16H29F3N4S and a molecular weight of 366.50 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489927 |
| Molecular Formula | C16H29F3N4S |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H29F3N4S/c1-4-20-14(23-7-8-24-15(2,3)11-23)21-9-13-5-6-22(10-13)12-16(17,18)19/h13H,4-12H2,1-3H3,(H,20,21) |
| InChIKey | MXBWIYXRBMMOEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|