C14H28IN3OS — CID 109489280
N-ethyl-2,2-dimethyl-N'-(oxolan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489280) has the molecular formula C14H28IN3OS and a molecular weight of 413.37 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-(oxolan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-(oxolan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489280 |
| Molecular Formula | C14H28IN3OS |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-(oxolan-2-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCO1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C14H27N3OS.HI/c1-4-15-13(16-10-12-6-5-8-18-12)17-7-9-19-14(2,3)11-17;/h12H,4-11H2,1-3H3,(H,15,16);1H |
| InChIKey | JSGHBEPNYHNCJC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|