C16H34IN5S — CID 109488054
N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488054) has the molecular formula C16H34IN5S and a molecular weight of 455.45 g/mol. Its IUPAC name is N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488054 |
| Molecular Formula | C16H34IN5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CN(C)CCN1C)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C16H33N5S.HI/c1-6-17-15(21-9-10-22-16(2,3)13-21)18-11-14-12-19(4)7-8-20(14)5;/h14H,6-13H2,1-5H3,(H,17,18);1H |
| InChIKey | NJEBEXSJOSLNRG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|