C22H37IN4S — CID 109488210
N-ethyl-2,2-dimethyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488210) has the molecular formula C22H37IN4S and a molecular weight of 516.54 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488210 |
| Molecular Formula | C22H37IN4S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(CCc2ccccc2)C1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C22H36N4S.HI/c1-4-23-21(26-14-15-27-22(2,3)18-26)24-16-20-11-13-25(17-20)12-10-19-8-6-5-7-9-19;/h5-9,20H,4,10-18H2,1-3H3,(H,23,24);1H |
| InChIKey | ZICMGJZESLQFBT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|