C22H36N4OS — CID 109489961
N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109489961) has the molecular formula C22H36N4OS and a molecular weight of 404.62 g/mol. Its IUPAC name is N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489961 |
| Molecular Formula | C22H36N4OS |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(CO)CC2)cc1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C22H36N4OS/c1-4-23-21(26-13-14-28-22(2,3)17-26)24-15-18-5-7-20(8-6-18)25-11-9-19(16-27)10-12-25/h5-8,19,27H,4,9-17H2,1-3H3,(H,23,24) |
| InChIKey | IKVQFVYKACHEIB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|