C19H31IN4O — CID 110982582
1-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110982582) has the molecular formula C19H31IN4O and a molecular weight of 458.39 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110982582 |
| Molecular Formula | C19H31IN4O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-ethyl-2-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1ccc(N2CCC(CO)CC2)cc1)NCC.I |
| InChI | InChI=1S/C19H30N4O.HI/c1-3-11-21-19(20-4-2)22-14-16-5-7-18(8-6-16)23-12-9-17(15-24)10-13-23;/h3,5-8,17,24H,1,4,9-15H2,2H3,(H2,20,21,22);1H |
| InChIKey | RPWVHRBPDZBMJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|