C24H38N4O — CID 109442701
N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442701) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442701 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | N-ethyl-N'-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(CO)CC2)cc1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C24H38N4O/c1-2-25-24(28-16-21-5-3-4-6-22(21)17-28)26-15-19-7-9-23(10-8-19)27-13-11-20(18-29)12-14-27/h7-10,20-22,29H,2-6,11-18H2,1H3,(H,25,26) |
| InChIKey | ZUVZTPAXXOHWKH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|