C23H38N6 — CID 109442763
N-ethyl-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442763) has the molecular formula C23H38N6 and a molecular weight of 398.60 g/mol. Its IUPAC name is N-ethyl-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442763 |
| Molecular Formula | C23H38N6 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | N-ethyl-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(CC)CC2)c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C23H38N6/c1-3-24-23(29-17-20-7-5-6-8-21(20)18-29)26-16-19-9-10-25-22(15-19)28-13-11-27(4-2)12-14-28/h9-10,15,20-21H,3-8,11-14,16-18H2,1-2H3,(H,24,26) |
| InChIKey | WUJPLZHFMCIYBE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|