C24H41N7 — CID 111918717
1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111918717) has the molecular formula C24H41N7 and a molecular weight of 427.64 g/mol. Its IUPAC name is 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111918717 |
| Molecular Formula | C24H41N7 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.34 |
| IUPAC Name | 1-(1-cyclopentylpyrrolidin-3-yl)-3-ethyl-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(CC)CC2)c1)NC1CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C24H41N7/c1-3-25-24(28-21-10-12-31(19-21)22-7-5-6-8-22)27-18-20-9-11-26-23(17-20)30-15-13-29(4-2)14-16-30/h9,11,17,21-22H,3-8,10,12-16,18-19H2,1-2H3,(H2,25,27,28) |
| InChIKey | ALHMARCPAXFGFL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|