C17H25IN4 — CID 111790766
2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111790766) has the molecular formula C17H25IN4 and a molecular weight of 412.32 g/mol. Its IUPAC name is 2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111790766 |
| Molecular Formula | C17H25IN4 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1ccc(N2CC=CC2)cc1)NCC.I |
| InChI | InChI=1S/C17H24N4.HI/c1-3-11-19-17(18-4-2)20-14-15-7-9-16(10-8-15)21-12-5-6-13-21;/h3,5-10H,1,4,11-14H2,2H3,(H2,18,19,20);1H |
| InChIKey | VYXXNCPPPZUBDC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|