C18H30N6 — CID 110979966
1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine (PubChem CID 110979966) has the molecular formula C18H30N6 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110979966 |
| Molecular Formula | C18H30N6 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 1-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/Cc1ccc(N2CCN(CC)CC2)nc1)NCC |
| InChI | InChI=1S/C18H30N6/c1-4-9-20-18(19-5-2)22-15-16-7-8-17(21-14-16)24-12-10-23(6-3)11-13-24/h4,7-8,14H,1,5-6,9-13,15H2,2-3H3,(H2,19,20,22) |
| InChIKey | BVIYADLKPJXRLU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|