C25H37N7 — CID 110960785
N-ethyl-N'-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-phenylpiperazine-1-carboximidamide (PubChem CID 110960785) has the molecular formula C25H37N7 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-ethyl-N'-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110960785 |
| Molecular Formula | C25H37N7 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | N-ethyl-N'-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-4-phenylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(CC)CC2)nc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H37N7/c1-3-26-25(32-18-16-30(17-19-32)23-8-6-5-7-9-23)28-21-22-10-11-24(27-20-22)31-14-12-29(4-2)13-15-31/h5-11,20H,3-4,12-19,21H2,1-2H3,(H,26,28) |
| InChIKey | GEZWMCIDXDFFDM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|