C24H35FIN7 — CID 111148180
N-ethyl-4-(2-fluorophenyl)-N'-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111148180) has the molecular formula C24H35FIN7 and a molecular weight of 567.50 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111148180 |
| Molecular Formula | C24H35FIN7 |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C24H34FN7.HI/c1-3-26-24(32-16-14-30(15-17-32)22-7-5-4-6-21(22)25)28-19-20-8-9-23(27-18-20)31-12-10-29(2)11-13-31;/h4-9,18H,3,10-17,19H2,1-2H3,(H,26,28);1H |
| InChIKey | NQDDJVBYVYROBI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|