C24H34N6O — CID 111133857
N-ethyl-4-(2-methoxyphenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111133857) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111133857 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-N'-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCCC2)nc1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C24H34N6O/c1-3-25-24(27-19-20-10-11-23(26-18-20)29-12-6-7-13-29)30-16-14-28(15-17-30)21-8-4-5-9-22(21)31-2/h4-5,8-11,18H,3,6-7,12-17,19H2,1-2H3,(H,25,27) |
| InChIKey | UWCWMEOPLCSCMW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|