C24H46IN7 — CID 110997874
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 110997874) has the molecular formula C24H46IN7 and a molecular weight of 559.59 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110997874 |
| Molecular Formula | C24H46IN7 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(CC)CC2)nc1)NC(C)CCCN(CC)CC.I |
| InChI | InChI=1S/C24H45N7.HI/c1-6-25-24(28-21(5)11-10-14-29(7-2)8-3)27-20-22-12-13-23(26-19-22)31-17-15-30(9-4)16-18-31;/h12-13,19,21H,6-11,14-18,20H2,1-5H3,(H2,25,27,28);1H |
| InChIKey | LDLNGFLHLLVBIO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|