C24H37IN6 — CID 111171562
1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(4-phenylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111171562) has the molecular formula C24H37IN6 and a molecular weight of 536.51 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(4-phenylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111171562 |
| Molecular Formula | C24H37IN6 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C24H36N6.HI/c1-4-25-24(28-20(2)10-11-21-8-6-5-7-9-21)27-19-22-12-13-23(26-18-22)30-16-14-29(3)15-17-30;/h5-9,12-13,18,20H,4,10-11,14-17,19H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | PZNARFBYBNBXIW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|