C22H31ClN6 — CID 111882571
1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111882571) has the molecular formula C22H31ClN6 and a molecular weight of 414.99 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111882571 |
| Molecular Formula | C22H31ClN6 |
| Molecular Weight | 414.99 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)NCCc1ccccc1Cl |
| InChI | InChI=1S/C22H31ClN6/c1-3-24-22(25-11-10-19-6-4-5-7-20(19)23)27-17-18-8-9-21(26-16-18)29-14-12-28(2)13-15-29/h4-9,16H,3,10-15,17H2,1-2H3,(H2,24,25,27) |
| InChIKey | SUHQEFCMGYRWPS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.99 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|