C25H36N6O — CID 111577477
1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111577477) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111577477 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)NCc1ccccc1OCC1CC1 |
| InChI | InChI=1S/C25H36N6O/c1-3-26-25(29-18-22-6-4-5-7-23(22)32-19-20-8-9-20)28-17-21-10-11-24(27-16-21)31-14-12-30(2)13-15-31/h4-7,10-11,16,20H,3,8-9,12-15,17-19H2,1-2H3,(H2,26,28,29) |
| InChIKey | CZFNHVPKZXRHLP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|