C25H34IN5O2 — CID 111576872
1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111576872) has the molecular formula C25H34IN5O2 and a molecular weight of 563.48 g/mol. Its IUPAC name is 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111576872 |
| Molecular Formula | C25H34IN5O2 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-ethyl-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCc1ccccc1OCC1CC1.I |
| InChI | InChI=1S/C25H33N5O2.HI/c1-2-26-25(29-16-21-5-3-4-6-23(21)32-18-20-7-8-20)28-15-19-9-11-22(12-10-19)30-14-13-27-24(31)17-30;/h3-6,9-12,20H,2,7-8,13-18H2,1H3,(H,27,31)(H2,26,28,29);1H |
| InChIKey | LUICPXSHPHXXNV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|