C24H33N7 — CID 110997307
1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 110997307) has the molecular formula C24H33N7 and a molecular weight of 419.58 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 110997307 |
| Molecular Formula | C24H33N7 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H33N7/c1-3-25-24(26-11-10-20-18-27-22-7-5-4-6-21(20)22)29-17-19-8-9-23(28-16-19)31-14-12-30(2)13-15-31/h4-9,16,18,27H,3,10-15,17H2,1-2H3,(H2,25,26,29) |
| InChIKey | DYMKZSMZVBPLPM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|