C23H30N6O — CID 86875693
1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea (PubChem CID 86875693) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 86875693 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]urea |
| SMILES | Cc1ccc2c(CCNC(=O)NCc3ccc(N4CCN(C)CC4)nc3)c[nH]c2c1 |
| InChI | InChI=1S/C23H30N6O/c1-17-3-5-20-19(16-25-21(20)13-17)7-8-24-23(30)27-15-18-4-6-22(26-14-18)29-11-9-28(2)10-12-29/h3-6,13-14,16,25H,7-12,15H2,1-2H3,(H2,24,27,30) |
| InChIKey | BUESXUONGDBSNG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |