C24H33N7 — CID 111973744
2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111973744) has the molecular formula C24H33N7 and a molecular weight of 419.58 g/mol. Its IUPAC name is 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111973744 |
| Molecular Formula | C24H33N7 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C24H33N7/c1-18-4-5-21-20(17-28-22(21)14-18)7-9-27-24(25-2)29-16-19-6-8-26-23(15-19)31-12-10-30(3)11-13-31/h4-6,8,14-15,17,28H,7,9-13,16H2,1-3H3,(H2,25,27,29) |
| InChIKey | PYGDMAAHXPBDID-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|