C19H29N7S — CID 111934637
2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111934637) has the molecular formula C19H29N7S and a molecular weight of 387.56 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111934637 |
| Molecular Formula | C19H29N7S |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H29N7S/c1-15-24-17(14-27-15)5-7-22-19(20-2)23-13-16-4-6-21-18(12-16)26-10-8-25(3)9-11-26/h4,6,12,14H,5,7-11,13H2,1-3H3,(H2,20,22,23) |
| InChIKey | RQZYWWXLBGSCME-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|