C21H29ClN6 — CID 111883279
1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111883279) has the molecular formula C21H29ClN6 and a molecular weight of 400.96 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111883279 |
| Molecular Formula | C21H29ClN6 |
| Molecular Weight | 400.96 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccccc1Cl)NCc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C21H29ClN6/c1-23-21(25-10-8-18-5-3-4-6-19(18)22)26-16-17-7-9-24-20(15-17)28-13-11-27(2)12-14-28/h3-7,9,15H,8,10-14,16H2,1-2H3,(H2,23,25,26) |
| InChIKey | FGNSOZQZWLLIET-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|