C25H38N6 — CID 111694332
1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111694332) has the molecular formula C25H38N6 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111694332 |
| Molecular Formula | C25H38N6 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 1-(2-ethyl-2-phenylbutyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCC(CC)(CN/C(=N\C)NCc1ccnc(N2CCN(C)CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C25H38N6/c1-5-25(6-2,22-10-8-7-9-11-22)20-29-24(26-3)28-19-21-12-13-27-23(18-21)31-16-14-30(4)15-17-31/h7-13,18H,5-6,14-17,19-20H2,1-4H3,(H2,26,28,29) |
| InChIKey | RUMJXCCCKYFIBJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|