C22H39IN6 — CID 111947692
1-(3-cyclohexylpropyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111947692) has the molecular formula C22H39IN6 and a molecular weight of 514.50 g/mol. Its IUPAC name is 1-(3-cyclohexylpropyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexylpropyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111947692 |
| Molecular Formula | C22H39IN6 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1-(3-cyclohexylpropyl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC1CCCCC1)NCc1ccnc(N2CCN(C)CC2)c1.I |
| InChI | InChI=1S/C22H38N6.HI/c1-23-22(25-11-6-9-19-7-4-3-5-8-19)26-18-20-10-12-24-21(17-20)28-15-13-27(2)14-16-28;/h10,12,17,19H,3-9,11,13-16,18H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | YRGBEHWDKWJLPV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|