C20H35IN6O — CID 111392108
1-[3-(cyclopropylmethoxy)propyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111392108) has the molecular formula C20H35IN6O and a molecular weight of 502.45 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111392108 |
| Molecular Formula | C20H35IN6O |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CC1)NCc1ccnc(N2CCN(C)CC2)c1.I |
| InChI | InChI=1S/C20H34N6O.HI/c1-21-20(23-7-3-13-27-16-17-4-5-17)24-15-18-6-8-22-19(14-18)26-11-9-25(2)10-12-26;/h6,8,14,17H,3-5,7,9-13,15-16H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | BVJSYVBTQKBPTC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|