C16H25IN6S — CID 111932969
1-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111932969) has the molecular formula C16H25IN6S and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111932969 |
| Molecular Formula | C16H25IN6S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1ccnc(N(C)C)c1.I |
| InChI | InChI=1S/C16H24N6S.HI/c1-12-21-14(11-23-12)6-8-19-16(17-2)20-10-13-5-7-18-15(9-13)22(3)4;/h5,7,9,11H,6,8,10H2,1-4H3,(H2,17,19,20);1H |
| InChIKey | BLLSGHDEFFWOBX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|