C23H30N4O3 — CID 111377106
2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111377106) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111377106 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-15-6-7-18-17(14-26-19(18)10-15)8-9-25-23(24-2)27-13-16-11-20(28-3)22(30-5)21(12-16)29-4/h6-7,10-12,14,26H,8-9,13H2,1-5H3,(H2,24,25,27) |
| InChIKey | TZFUYHBEDVWCSV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|