C25H33N5O — CID 110995213
N,N-diethyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide (PubChem CID 110995213) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is N,N-diethyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 110995213 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | N,N-diethyl-4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(CC)CC)cc1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H33N5O/c1-4-26-25(27-16-15-21-18-28-23-10-8-7-9-22(21)23)29-17-19-11-13-20(14-12-19)24(31)30(5-2)6-3/h7-14,18,28H,4-6,15-17H2,1-3H3,(H2,26,27,29) |
| InChIKey | URMFNXMNWUUQBQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|