C22H27N5O — CID 110995217
4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 110995217) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110995217 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-[[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC)cc1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H27N5O/c1-3-24-22(27-14-16-8-10-17(11-9-16)21(28)23-2)25-13-12-18-15-26-20-7-5-4-6-19(18)20/h4-11,15,26H,3,12-14H2,1-2H3,(H,23,28)(H2,24,25,27) |
| InChIKey | KBUDGLHTSFYODB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|