C25H31IN6O2 — CID 110995228
1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110995228) has the molecular formula C25H31IN6O2 and a molecular weight of 574.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110995228 |
| Molecular Formula | C25H31IN6O2 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C25H30N6O2.HI/c1-2-26-25(28-12-11-20-16-29-22-6-4-3-5-21(20)22)30-15-18-7-9-19(10-8-18)24(33)31-14-13-27-23(32)17-31;/h3-10,16,29H,2,11-15,17H2,1H3,(H,27,32)(H2,26,28,30);1H |
| InChIKey | OAPXJAFXOJSUNE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|